C19H36O5Si — CID 134780043
[(Z,3R)-6-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-en-2-yl] 2,2-dimethylpropanoate (PubChem CID 134780043) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is [(Z,3R)-6-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-en-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(Z,3R)-6-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-en-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134780043 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(Z,3R)-6-acetyloxy-3-[tert-butyl(dimethyl)silyl]oxyhex-5-en-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)O/C=C\C[C@@H](O[Si](C)(C)C(C)(C)C)C(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H36O5Si/c1-14(23-17(21)18(3,4)5)16(12-11-13-22-15(2)20)24-25(9,10)19(6,7)8/h11,13-14,16H,12H2,1-10H3/b13-11-/t14?,16-/m1/s1 |
| InChIKey | XVTNRFPREODEJE-WXMOLBAOSA-N |
| XLogP | 4.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|