C26H52O4Si2 — CID 10696242
[(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enyl] 2,2-dimethylpropanoate (PubChem CID 10696242) has the molecular formula C26H52O4Si2 and a molecular weight of 484.87 g/mol. Its IUPAC name is [(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10696242 |
| Molecular Formula | C26H52O4Si2 |
| Molecular Weight | 484.87 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | [(2R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CCC(CC=C)(O[Si](C)(C)C(C)(C)C)[C@@H](COC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O4Si2/c1-16-18-26(19-17-2,30-32(14,15)25(9,10)11)21(20-28-22(27)23(3,4)5)29-31(12,13)24(6,7)8/h16-17,21H,1-2,18-20H2,3-15H3/t21-/m1/s1 |
| InChIKey | PFKKKUKRNXNBKS-OAQYLSRUSA-N |
| XLogP | 7.88 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.87 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|