C22H45IO4Si2 — CID 11699666
[(E,2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5-iodopent-4-enyl] 2,2-dimethylpropanoate (PubChem CID 11699666) has the molecular formula C22H45IO4Si2 and a molecular weight of 556.67 g/mol. Its IUPAC name is [(E,2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5-iodopent-4-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5-iodopent-4-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11699666 |
| Molecular Formula | C22H45IO4Si2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | [(E,2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5-iodopent-4-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H45IO4Si2/c1-20(2,3)19(24)25-16-18(27-29(12,13)22(7,8)9)17(14-15-23)26-28(10,11)21(4,5)6/h14-15,17-18H,16H2,1-13H3/b15-14+/t17-,18-/m1/s1 |
| InChIKey | QBZSEWZBKCJNPZ-NVGHFZOBSA-N |
| XLogP | 7.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|