About [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate
[(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate (PubChem CID 71712630) has the molecular formula C21H44O4Si2
and a molecular weight of 416.75 g/mol. Its IUPAC name is [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate |
| PubChem CID | 71712630 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate |
| SMILES | C=C(O[Si](C)(C)C)[C@H](COC(=O)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H44O4Si2/c1-15(2)27(16(3)4,17(5)6)25-19(18(7)24-26(11,12)13)14-23-20(22)21(8,9)10/h15-17,19H,7,14H2,1-6,8-13H3/t19-/m0/s1 |
| InChIKey | ASISXWLDBPBNND-IBGZPJMESA-N |
| XLogP | 6.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate?
The IUPAC name of [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate (CID 71712630) is [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate is C=C(O[Si](C)(C)C)[C@H](COC(=O)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate?
The InChIKey is ASISXWLDBPBNND-IBGZPJMESA-N. The full InChI is InChI=1S/C21H44O4Si2/c1-15(2)27(16(3)4,17(5)6)25-19(18(7)24-26(11,12)13)14-23-20(22)21(8,9)10/h15-17,19H,7,14H2,1-6,8-13H3/t19-/m0/s1.
What are the key properties of [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate?
[(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate has a molecular weight of 416.75 g/mol, XLogP of 6.50, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-3-trimethylsilyloxy-2-tri(propan-2-yl)silyloxybut-3-enyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 71712630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).