C57H96O6 — CID 134782059
[3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate (PubChem CID 134782059) has the molecular formula C57H96O6 and a molecular weight of 877.39 g/mol. Its IUPAC name is [3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate.
| Compound Name | [3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 134782059 |
| Molecular Formula | C57H96O6 |
| Molecular Weight | 877.39 g/mol |
| Exact Mass | 876.72 |
| IUPAC Name | [3-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropyl] (5E,8E,11E)-icosa-5,8,11-trienoate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OCC(COC(=O)CCC/C=C/C/C=C/C/C=C/CCCCCCCC)OC(=O)CCCCCCCCC/C=C/CCCCCC |
| InChI | InChI=1S/C57H96O6/c1-4-7-10-13-16-19-22-25-27-28-30-32-35-38-41-44-47-50-56(59)62-53-54(52-61-55(58)49-46-43-40-37-34-31-24-21-18-15-12-9-6-3)63-57(60)51-48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2/h9,12,15,18,20-21,23-25,27,30,32,38,41,54H,4-8,10-11,13-14,16-17,19,22,26,28-29,31,33-37,39-40,42-53H2,1-3H3/b12-9+,18-15+,23-20+,24-21+,27-25+,32-30+,41-38+ |
| InChIKey | YOLKEKLCPMTSLK-CZBFWMMRSA-N |
| XLogP | 17.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.39 |
| LogP ≤ 5 | 17.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|