C59H92O6 — CID 138126864
2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate (PubChem CID 138126864) has the molecular formula C59H92O6 and a molecular weight of 897.38 g/mol. Its IUPAC name is 2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate.
| Compound Name | 2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 138126864 |
| Molecular Formula | C59H92O6 |
| Molecular Weight | 897.38 g/mol |
| Exact Mass | 896.69 |
| IUPAC Name | 2,3-bis[[(9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoyl]oxy]propyl (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
| SMILES | CC/C=C\C=C/C=C\C=C/CCCCCCCC(=O)OCC(COC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\C=C/C=C\C=C/CC |
| InChI | InChI=1S/C59H92O6/c1-4-7-10-13-16-19-22-25-28-29-32-34-37-40-43-46-49-52-58(61)64-55-56(65-59(62)53-50-47-44-41-38-35-31-27-24-21-18-15-12-9-6-3)54-63-57(60)51-48-45-42-39-36-33-30-26-23-20-17-14-11-8-5-2/h8-9,11-12,14-15,17-18,20-21,23-28,30-32,34,40,43,56H,4-7,10,13,16,19,22,29,33,35-39,41-42,44-55H2,1-3H3/b11-8-,12-9-,17-14-,18-15-,23-20-,24-21-,28-25-,30-26-,31-27-,34-32-,43-40- |
| InChIKey | BIKNDJJPDNNUMV-YPDKWYNQSA-N |
| XLogP | 17.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.38 |
| LogP ≤ 5 | 17.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|