C39H67NO7 — CID 134783646
4-[2-[(6E,9E)-dodeca-6,9-dienoyl]oxy-3-[(11E,14E)-heptadeca-11,14-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134783646) has the molecular formula C39H67NO7 and a molecular weight of 661.97 g/mol. Its IUPAC name is 4-[2-[(6E,9E)-dodeca-6,9-dienoyl]oxy-3-[(11E,14E)-heptadeca-11,14-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(6E,9E)-dodeca-6,9-dienoyl]oxy-3-[(11E,14E)-heptadeca-11,14-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134783646 |
| Molecular Formula | C39H67NO7 |
| Molecular Weight | 661.97 g/mol |
| Exact Mass | 661.49 |
| IUPAC Name | 4-[2-[(6E,9E)-dodeca-6,9-dienoyl]oxy-3-[(11E,14E)-heptadeca-11,14-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/CCCCCCCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C39H67NO7/c1-6-8-10-12-14-16-17-18-19-20-22-23-25-27-29-37(41)46-34-35(33-45-32-31-36(39(43)44)40(3,4)5)47-38(42)30-28-26-24-21-15-13-11-9-7-2/h8-11,14-16,21,35-36H,6-7,12-13,17-20,22-34H2,1-5H3/b10-8+,11-9+,16-14+,21-15+ |
| InChIKey | ZDALZLRCGWFLJB-YDECQTAESA-N |
| XLogP | 7.57 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.97 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|