C50H81NO7 — CID 138178719
4-[2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 138178719) has the molecular formula C50H81NO7 and a molecular weight of 808.20 g/mol. Its IUPAC name is 4-[2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 138178719 |
| Molecular Formula | C50H81NO7 |
| Molecular Weight | 808.20 g/mol |
| Exact Mass | 807.60 |
| IUPAC Name | 4-[2-[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl]oxy-3-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C50H81NO7/c1-6-8-10-12-14-16-18-20-22-23-24-25-27-29-31-33-35-37-39-41-49(53)58-46(44-56-43-42-47(50(54)55)51(3,4)5)45-57-48(52)40-38-36-34-32-30-28-26-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-22,24-26,29,31,46-47H,6-7,12-13,18-19,23,27-28,30,32-45H2,1-5H3/b10-8-,11-9-,16-14-,17-15-,22-20-,25-24-,26-21-,31-29- |
| InChIKey | INHKXKFVVVDBAF-VYOYHZJLSA-N |
| XLogP | 10.96 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.20 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|