C25H32N2O6 — CID 134786320
5-(furan-2-ylmethyl)-1-(2-hydroxy-3-prop-2-enoxypropyl)-8-methoxy-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one (PubChem CID 134786320) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is 5-(furan-2-ylmethyl)-1-(2-hydroxy-3-prop-2-enoxypropyl)-8-methoxy-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one.
| Compound Name | 5-(furan-2-ylmethyl)-1-(2-hydroxy-3-prop-2-enoxypropyl)-8-methoxy-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one |
|---|---|
| PubChem CID | 134786320 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 5-(furan-2-ylmethyl)-1-(2-hydroxy-3-prop-2-enoxypropyl)-8-methoxy-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one |
| SMILES | C=CCOCC(O)CN1CCC(=O)N(Cc2ccco2)Cc2c1ccc(OC)c2OCC=C |
| InChI | InChI=1S/C25H32N2O6/c1-4-12-31-18-19(28)15-26-11-10-24(29)27(16-20-7-6-14-32-20)17-21-22(26)8-9-23(30-3)25(21)33-13-5-2/h4-9,14,19,28H,1-2,10-13,15-18H2,3H3 |
| InChIKey | VXSFXCPKUPHZBX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|