C25H34N2O6 — CID 134786232
1-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-8-methoxy-5-propan-2-yl-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one (PubChem CID 134786232) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is 1-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-8-methoxy-5-propan-2-yl-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one.
| Compound Name | 1-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-8-methoxy-5-propan-2-yl-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one |
|---|---|
| PubChem CID | 134786232 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]-8-methoxy-5-propan-2-yl-7-prop-2-enoxy-3,6-dihydro-2H-1,5-benzodiazocin-4-one |
| SMILES | C=CCOc1c(OC)ccc2c1CN(C(C)C)C(=O)CCN2CC(O)COCc1ccco1 |
| InChI | InChI=1S/C25H34N2O6/c1-5-12-33-25-21-15-27(18(2)3)24(29)10-11-26(22(21)8-9-23(25)30-4)14-19(28)16-31-17-20-7-6-13-32-20/h5-9,13,18-19,28H,1,10-12,14-17H2,2-4H3 |
| InChIKey | LGPLACDQIYBXJU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|