C25H28N2O5 — CID 134786533
ethyl (1R,2S,3aS,9bS)-3-acetyl-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate (PubChem CID 134786533) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is ethyl (1R,2S,3aS,9bS)-3-acetyl-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate.
| Compound Name | ethyl (1R,2S,3aS,9bS)-3-acetyl-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 134786533 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | ethyl (1R,2S,3aS,9bS)-3-acetyl-5-(2-methoxyethyl)-4-oxo-2-phenyl-1,2,3a,9b-tetrahydropyrrolo[2,3-c]quinoline-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2c3ccccc3N(CCOC)C(=O)[C@H]2N(C(C)=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H28N2O5/c1-4-32-25(30)21-20-18-12-8-9-13-19(18)26(14-15-31-3)24(29)23(20)27(16(2)28)22(21)17-10-6-5-7-11-17/h5-13,20-23H,4,14-15H2,1-3H3/t20-,21-,22-,23+/m1/s1 |
| InChIKey | FOKHBJFDWCXNDF-ODAXIHTASA-N |
| XLogP | 2.91 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |