C22H18FN3O3S — CID 134787407
CID 134787407 (PubChem CID 134787407) has the molecular formula C22H18FN3O3S and a molecular weight of 423.47 g/mol.
| Compound Name | CID 134787407 |
|---|---|
| PubChem CID | 134787407 |
| Molecular Formula | C22H18FN3O3S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])c1ccc(-c2nc(C(=O)NCc3ccc(F)cc3)n3ccccc23)cc1 |
| InChI | InChI=1S/C22H18FN3O3S/c1-30(28,29)18-11-7-16(8-12-18)20-19-4-2-3-13-26(19)21(25-20)22(27)24-14-15-5-9-17(23)10-6-15/h2-13H,14H2,1H3,(H-,24,27,28,29) |
| InChIKey | WTBVWXUVRNJJGX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|