C17H24N2O3S — CID 134787444
CID 134787444 (PubChem CID 134787444) has the molecular formula C17H24N2O3S and a molecular weight of 336.50 g/mol.
| Compound Name | CID 134787444 |
|---|---|
| PubChem CID | 134787444 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | — |
| SMILES | C[S+](=O)(N1CC2(CCN(CC2)C3COC3)CC4=CC=CC=C41)[O-] |
| InChI | InChI=1S/C17H24N2O3S/c1-23(20,21)19-13-17(10-14-4-2-3-5-16(14)19)6-8-18(9-7-17)15-11-22-12-15/h2-5,15H,6-13H2,1H3 |
| InChIKey | HLUOUMDNRBLDSC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 56.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | 480 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|