C17H29N3O2 — CID 134789102
tert-butyl 3-[5-(2-methylpropyl)-1H-imidazol-2-yl]piperidine-1-carboxylate (PubChem CID 134789102) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl 3-[5-(2-methylpropyl)-1H-imidazol-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[5-(2-methylpropyl)-1H-imidazol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134789102 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl 3-[5-(2-methylpropyl)-1H-imidazol-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)Cc1cnc(C2CCCN(C(=O)OC(C)(C)C)C2)[nH]1 |
| InChI | InChI=1S/C17H29N3O2/c1-12(2)9-14-10-18-15(19-14)13-7-6-8-20(11-13)16(21)22-17(3,4)5/h10,12-13H,6-9,11H2,1-5H3,(H,18,19) |
| InChIKey | DBVPQPVZYXKIOI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |