C20H25N3O2S — CID 134789135
CID 134789135 (PubChem CID 134789135) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol.
| Compound Name | CID 134789135 |
|---|---|
| PubChem CID | 134789135 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])N1CC2(CCCN(Cc3ccccn3)C2)Cc2ccccc21 |
| InChI | InChI=1S/C20H25N3O2S/c1-26(24,25)23-16-20(13-17-7-2-3-9-19(17)23)10-6-12-22(15-20)14-18-8-4-5-11-21-18/h2-5,7-9,11H,6,10,12-16H2,1H3 |
| InChIKey | DSBPUQJYCBTHEP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|