C17H19N3O3S — CID 134789278
CID 134789278 (PubChem CID 134789278) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol.
| Compound Name | CID 134789278 |
|---|---|
| PubChem CID | 134789278 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NC2(CCN(Cc3ccccc3)C2)COc2ccncc21 |
| InChI | InChI=1S/C17H19N3O3S/c21-24(22)16-10-18-8-6-15(16)23-13-17(19-24)7-9-20(12-17)11-14-4-2-1-3-5-14/h1-6,8,10H,7,9,11-13H2,(H-,19,21,22) |
| InChIKey | BQWHZCPRTBLQCN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|