C15H17N3O4S — CID 134789387
CID 134789387 (PubChem CID 134789387) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol.
| Compound Name | CID 134789387 |
|---|---|
| PubChem CID | 134789387 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NC2(CCN(Cc3ccoc3)C2)COc2ccncc21 |
| InChI | InChI=1S/C15H17N3O4S/c19-23(20)14-7-16-4-1-13(14)22-11-15(17-23)3-5-18(10-15)8-12-2-6-21-9-12/h1-2,4,6-7,9H,3,5,8,10-11H2,(H-,17,19,20) |
| InChIKey | VOFMSXBFDMCDEI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|