C19H22N4O3 — CID 26231515
8-(furan-3-ylmethyl)-1-methyl-3-(pyridin-3-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26231515) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 8-(furan-3-ylmethyl)-1-methyl-3-(pyridin-3-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(furan-3-ylmethyl)-1-methyl-3-(pyridin-3-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26231515 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 8-(furan-3-ylmethyl)-1-methyl-3-(pyridin-3-ylmethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)N(Cc2cccnc2)C(=O)C12CCN(Cc1ccoc1)CC2 |
| InChI | InChI=1S/C19H22N4O3/c1-21-18(25)23(13-15-3-2-7-20-11-15)17(24)19(21)5-8-22(9-6-19)12-16-4-10-26-14-16/h2-4,7,10-11,14H,5-6,8-9,12-13H2,1H3 |
| InChIKey | DRGYYHIIOWFJGQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|