C20H22N4O4 — CID 162792601
1'-(furan-3-ylmethyl)-7-hydroxy-2-(pyridin-3-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione (PubChem CID 162792601) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1'-(furan-3-ylmethyl)-7-hydroxy-2-(pyridin-3-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione.
| Compound Name | 1'-(furan-3-ylmethyl)-7-hydroxy-2-(pyridin-3-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
|---|---|
| PubChem CID | 162792601 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1'-(furan-3-ylmethyl)-7-hydroxy-2-(pyridin-3-ylmethyl)spiro[6,7,8,8a-tetrahydropyrrolo[1,2-a]pyrazine-4,3'-azetidine]-1,3-dione |
| SMILES | O=C1C2CC(O)CN2C2(CN(Cc3ccoc3)C2)C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C20H22N4O4/c25-16-6-17-18(26)23(9-14-2-1-4-21-7-14)19(27)20(24(17)10-16)12-22(13-20)8-15-3-5-28-11-15/h1-5,7,11,16-17,25H,6,8-10,12-13H2 |
| InChIKey | MXMCXXBCXGWUJG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|