C18H21N3O2 — CID 131646046
8-(furan-3-ylmethyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 131646046) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 8-(furan-3-ylmethyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(furan-3-ylmethyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 131646046 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 8-(furan-3-ylmethyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1CC(c2ccncc2)C2(CCN(Cc3ccoc3)CC2)N1 |
| InChI | InChI=1S/C18H21N3O2/c22-17-11-16(15-1-6-19-7-2-15)18(20-17)4-8-21(9-5-18)12-14-3-10-23-13-14/h1-3,6-7,10,13,16H,4-5,8-9,11-12H2,(H,20,22) |
| InChIKey | BVESIXZNAZNAGW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |