C17H19N5O — CID 131640509
4-pyridin-4-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 131640509) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-pyridin-4-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 4-pyridin-4-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 131640509 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-pyridin-4-yl-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1CC(c2ccncc2)C2(CCN(c3ncccn3)CC2)N1 |
| InChI | InChI=1S/C17H19N5O/c23-15-12-14(13-2-8-18-9-3-13)17(21-15)4-10-22(11-5-17)16-19-6-1-7-20-16/h1-3,6-9,14H,4-5,10-12H2,(H,21,23) |
| InChIKey | VBWNBASUQKEHRP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |