C18H19N3O2S — CID 97469996
(4S)-4-pyridin-4-yl-8-(thiophene-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97469996) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is (4S)-4-pyridin-4-yl-8-(thiophene-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (4S)-4-pyridin-4-yl-8-(thiophene-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97469996 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (4S)-4-pyridin-4-yl-8-(thiophene-3-carbonyl)-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1C[C@@H](c2ccncc2)C2(CCN(C(=O)c3ccsc3)CC2)N1 |
| InChI | InChI=1S/C18H19N3O2S/c22-16-11-15(13-1-6-19-7-2-13)18(20-16)4-8-21(9-5-18)17(23)14-3-10-24-12-14/h1-3,6-7,10,12,15H,4-5,8-9,11H2,(H,20,22)/t15-/m0/s1 |
| InChIKey | USLSQSISXANJPY-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |