C21H23N3O2 — CID 134070711
8-(4-methylbenzoyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 134070711) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 8-(4-methylbenzoyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-(4-methylbenzoyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 134070711 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 8-(4-methylbenzoyl)-4-pyridin-4-yl-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | Cc1ccc(C(=O)N2CCC3(CC2)NC(=O)CC3c2ccncc2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-15-2-4-17(5-3-15)20(26)24-12-8-21(9-13-24)18(14-19(25)23-21)16-6-10-22-11-7-16/h2-7,10-11,18H,8-9,12-14H2,1H3,(H,23,25) |
| InChIKey | GCCGBFBOCRDJTB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |