C19H21N3O2S — CID 97391832
(4S)-4-pyridin-4-yl-8-(2-thiophen-2-ylacetyl)-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 97391832) has the molecular formula C19H21N3O2S and a molecular weight of 355.46 g/mol. Its IUPAC name is (4S)-4-pyridin-4-yl-8-(2-thiophen-2-ylacetyl)-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (4S)-4-pyridin-4-yl-8-(2-thiophen-2-ylacetyl)-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 97391832 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (4S)-4-pyridin-4-yl-8-(2-thiophen-2-ylacetyl)-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1C[C@@H](c2ccncc2)C2(CCN(C(=O)Cc3cccs3)CC2)N1 |
| InChI | InChI=1S/C19H21N3O2S/c23-17-13-16(14-3-7-20-8-4-14)19(21-17)5-9-22(10-6-19)18(24)12-15-2-1-11-25-15/h1-4,7-8,11,16H,5-6,9-10,12-13H2,(H,21,23)/t16-/m0/s1 |
| InChIKey | SMQAYUXXTATAQU-INIZCTEOSA-N |
| XLogP | 2.35 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |