C17H15ClN4O3S — CID 134789477
CID 134789477 (PubChem CID 134789477) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol.
| Compound Name | CID 134789477 |
|---|---|
| PubChem CID | 134789477 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | — |
| SMILES | O=c1n(-c2cccc(Cl)c2)nc2n1CCN([S+](=O)([O-])c1ccccc1)C2 |
| InChI | InChI=1S/C17H15ClN4O3S/c18-13-5-4-6-14(11-13)22-17(23)21-10-9-20(12-16(21)19-22)26(24,25)15-7-2-1-3-8-15/h1-8,11H,9-10,12H2 |
| InChIKey | WYOBHAQMERCBFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|