C15H26N4O3 — CID 134790481
N-[4-oxo-4-(3-oxo-4-piperidin-4-ylpiperazin-1-yl)butyl]acetamide (PubChem CID 134790481) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[4-oxo-4-(3-oxo-4-piperidin-4-ylpiperazin-1-yl)butyl]acetamide.
| Compound Name | N-[4-oxo-4-(3-oxo-4-piperidin-4-ylpiperazin-1-yl)butyl]acetamide |
|---|---|
| PubChem CID | 134790481 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | N-[4-oxo-4-(3-oxo-4-piperidin-4-ylpiperazin-1-yl)butyl]acetamide |
| SMILES | CC(=O)NCCCC(=O)N1CCN(C2CCNCC2)C(=O)C1 |
| InChI | InChI=1S/C15H26N4O3/c1-12(20)17-6-2-3-14(21)18-9-10-19(15(22)11-18)13-4-7-16-8-5-13/h13,16H,2-11H2,1H3,(H,17,20) |
| InChIKey | ZQHQNJCCIGSCPC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|