C19H20FN3O3S — CID 134791990
CID 134791990 (PubChem CID 134791990) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol.
| Compound Name | CID 134791990 |
|---|---|
| PubChem CID | 134791990 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | — |
| SMILES | O=C(c1ccccc1F)N1CCC2(CC1)CN[S+](=O)([O-])c1ccccc1N2 |
| InChI | InChI=1S/C19H20FN3O3S/c20-15-6-2-1-5-14(15)18(24)23-11-9-19(10-12-23)13-21-27(25,26)17-8-4-3-7-16(17)22-19/h1-8H,9-13H2,(H2-,21,22,25,26) |
| InChIKey | GRDXDOPKZSJZDN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|