C18H20N4O3S — CID 134800933
CID 134800933 (PubChem CID 134800933) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol.
| Compound Name | CID 134800933 |
|---|---|
| PubChem CID | 134800933 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | — |
| SMILES | O=C(c1ccccc1)N1CCCC2(CN[S+](=O)([O-])c3cccnc3N2)C1 |
| InChI | InChI=1S/C18H20N4O3S/c23-17(14-6-2-1-3-7-14)22-11-5-9-18(13-22)12-20-26(24,25)15-8-4-10-19-16(15)21-18/h1-4,6-8,10H,5,9,11-13H2,(H2-,19,20,21,24,25) |
| InChIKey | LGWCVPQXUWHYAP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|