C19H19F3N4O3S — CID 134803717
CID 134803717 (PubChem CID 134803717) has the molecular formula C19H19F3N4O3S and a molecular weight of 440.45 g/mol.
| Compound Name | CID 134803717 |
|---|---|
| PubChem CID | 134803717 |
| Molecular Formula | C19H19F3N4O3S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | — |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCCC2(CNc3ncccc3[S+](=O)([O-])N2)C1 |
| InChI | InChI=1S/C19H19F3N4O3S/c20-19(21,22)14-6-4-13(5-7-14)17(27)26-10-2-8-18(12-26)11-24-16-15(3-1-9-23-16)30(28,29)25-18/h1,3-7,9H,2,8,10-12H2,(H2-,23,24,25,28,29) |
| InChIKey | UOAWZIJYRNFJGR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|