C15H23N5O3S — CID 134803507
CID 134803507 (PubChem CID 134803507) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol.
| Compound Name | CID 134803507 |
|---|---|
| PubChem CID | 134803507 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | — |
| SMILES | CN(C)CC(=O)N1CCCC2(CNc3ncccc3[S+](=O)([O-])N2)C1 |
| InChI | InChI=1S/C15H23N5O3S/c1-19(2)9-13(21)20-8-4-6-15(11-20)10-17-14-12(5-3-7-16-14)24(22,23)18-15/h3,5,7H,4,6,8-11H2,1-2H3,(H2-,16,17,18,22,23) |
| InChIKey | VNXQVJSKPOBWJK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|