C17H19N5O3S — CID 134802632
CID 134802632 (PubChem CID 134802632) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol.
| Compound Name | CID 134802632 |
|---|---|
| PubChem CID | 134802632 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | — |
| SMILES | O=C(c1cccnc1)N1CCCC2(CNc3ncccc3[S+](=O)([O-])N2)C1 |
| InChI | InChI=1S/C17H19N5O3S/c23-16(13-4-1-7-18-10-13)22-9-3-6-17(12-22)11-20-15-14(5-2-8-19-15)26(24,25)21-17/h1-2,4-5,7-8,10H,3,6,9,11-12H2,(H2-,19,20,21,24,25) |
| InChIKey | KNSLGBMHSOLTJV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|