C16H19N5O3S — CID 134788833
CID 134788833 (PubChem CID 134788833) has the molecular formula C16H19N5O3S and a molecular weight of 361.43 g/mol.
| Compound Name | CID 134788833 |
|---|---|
| PubChem CID | 134788833 |
| Molecular Formula | C16H19N5O3S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NCC2(CCCN(Cc3cnccn3)C2)Oc2ncccc21 |
| InChI | InChI=1S/C16H19N5O3S/c22-25(23)14-3-1-5-19-15(14)24-16(11-20-25)4-2-8-21(12-16)10-13-9-17-6-7-18-13/h1,3,5-7,9H,2,4,8,10-12H2,(H-,20,22,23) |
| InChIKey | JZHMPRRZNQQBTH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|