C17H23N5O2S — CID 134793623
CID 134793623 (PubChem CID 134793623) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol.
| Compound Name | CID 134793623 |
|---|---|
| PubChem CID | 134793623 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | — |
| SMILES | Cn1nccc1CN1CCCC2(CN[S+](=O)([O-])c3ccccc3N2)C1 |
| InChI | InChI=1S/C17H23N5O2S/c1-21-14(7-9-18-21)11-22-10-4-8-17(13-22)12-19-25(23,24)16-6-3-2-5-15(16)20-17/h2-3,5-7,9,20H,4,8,10-13H2,1H3,(H-,19,23,24) |
| InChIKey | UQWZKWHJDAMJLY-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|