C18H27N3O2S — CID 134793742
CID 134793742 (PubChem CID 134793742) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol.
| Compound Name | CID 134793742 |
|---|---|
| PubChem CID | 134793742 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NCC2(CCN(CC3CCCCC3)C2)Nc2ccccc21 |
| InChI | InChI=1S/C18H27N3O2S/c22-24(23)17-9-5-4-8-16(17)20-18(13-19-24)10-11-21(14-18)12-15-6-2-1-3-7-15/h4-5,8-9,15,20H,1-3,6-7,10-14H2,(H-,19,22,23) |
| InChIKey | UFTAKYYAFCHSLJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|