About CID 134793742
CID 134793742 (PubChem CID 134793742) has the molecular formula C18H27N3O2S
and a molecular weight of 349.50 g/mol.
Molecular Properties
| Compound Name | CID 134793742 |
| PubChem CID | 134793742 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NCC2(CCN(CC3CCCCC3)C2)Nc2ccccc21 |
| InChI | InChI=1S/C18H27N3O2S/c22-24(23)17-9-5-4-8-16(17)20-18(13-19-24)10-11-21(14-18)12-15-6-2-1-3-7-15/h4-5,8-9,15,20H,1-3,6-7,10-14H2,(H-,19,22,23) |
| InChIKey | UFTAKYYAFCHSLJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 134793742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134793742?
The IUPAC name of CID 134793742 (CID 134793742) is not available.
What is the SMILES notation for CID 134793742?
The canonical SMILES for CID 134793742 is O=[S+]1([O-])NCC2(CCN(CC3CCCCC3)C2)Nc2ccccc21.
What is the InChIKey of CID 134793742?
The InChIKey is UFTAKYYAFCHSLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2S/c22-24(23)17-9-5-4-8-16(17)20-18(13-19-24)10-11-21(14-18)12-15-6-2-1-3-7-15/h4-5,8-9,15,20H,1-3,6-7,10-14H2,(H-,19,22,23).
What are the key properties of CID 134793742?
CID 134793742 has a molecular weight of 349.50 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134793742 is sourced from PubChem (CID 134793742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).