C16H19N3O3S2 — CID 134787908
CID 134787908 (PubChem CID 134787908) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol.
| Compound Name | CID 134787908 |
|---|---|
| PubChem CID | 134787908 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | — |
| SMILES | O=[S+]1([O-])NCC2(CCN(Cc3cccs3)CC2)Oc2ncccc21 |
| InChI | InChI=1S/C16H19N3O3S2/c20-24(21)14-4-1-7-17-15(14)22-16(12-18-24)5-8-19(9-6-16)11-13-3-2-10-23-13/h1-4,7,10H,5-6,8-9,11-12H2,(H-,18,20,21) |
| InChIKey | JNHAJKQDZWJCGM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|