C17H16N4O2S — CID 134793690
CID 134793690 (PubChem CID 134793690) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol.
| Compound Name | CID 134793690 |
|---|---|
| PubChem CID | 134793690 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1ccccc1)N1CCn2c(nnc2-c2ccccc2)C1 |
| InChI | InChI=1S/C17H16N4O2S/c22-24(23,15-9-5-2-6-10-15)20-11-12-21-16(13-20)18-19-17(21)14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | JBWMUWYGUOJOLL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|