C23H25ClN6O2 — CID 134795090
[1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-[3-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone (PubChem CID 134795090) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is [1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-[3-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone.
| Compound Name | [1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-[3-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134795090 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [1-(6-chloropyridine-3-carbonyl)piperidin-4-yl]-[3-(1H-imidazo[4,5-b]pyridin-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)nc1)N1CCC(C(=O)N2CCCC(c3nc4ncccc4[nH]3)C2)CC1 |
| InChI | InChI=1S/C23H25ClN6O2/c24-19-6-5-16(13-26-19)23(32)29-11-7-15(8-12-29)22(31)30-10-2-3-17(14-30)20-27-18-4-1-9-25-21(18)28-20/h1,4-6,9,13,15,17H,2-3,7-8,10-12,14H2,(H,25,27,28) |
| InChIKey | AKAKLTZCYRCHEP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|