C21H27N5O2 — CID 134796519
(2S)-N-cyclopentyl-1-[4-(2-methoxyanilino)pyrimidin-2-yl]pyrrolidine-2-carboxamide (PubChem CID 134796519) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-1-[4-(2-methoxyanilino)pyrimidin-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-cyclopentyl-1-[4-(2-methoxyanilino)pyrimidin-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134796519 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | (2S)-N-cyclopentyl-1-[4-(2-methoxyanilino)pyrimidin-2-yl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccccc1Nc1ccnc(N2CCC[C@H]2C(=O)NC2CCCC2)n1 |
| InChI | InChI=1S/C21H27N5O2/c1-28-18-11-5-4-9-16(18)24-19-12-13-22-21(25-19)26-14-6-10-17(26)20(27)23-15-7-2-3-8-15/h4-5,9,11-13,15,17H,2-3,6-8,10,14H2,1H3,(H,23,27)(H,22,24,25)/t17-/m0/s1 |
| InChIKey | WRKWDHPBHCZMGG-KRWDZBQOSA-N |
| XLogP | 3.26 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |