C15H10FN3OS — CID 134797117
2-(4-fluorophenyl)-N-prop-2-ynylimidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134797117) has the molecular formula C15H10FN3OS and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-prop-2-ynylimidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-prop-2-ynylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 134797117 |
| Molecular Formula | C15H10FN3OS |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 2-(4-fluorophenyl)-N-prop-2-ynylimidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | C#CCNC(=O)c1cn2cc(-c3ccc(F)cc3)sc2n1 |
| InChI | InChI=1S/C15H10FN3OS/c1-2-7-17-14(20)12-8-19-9-13(21-15(19)18-12)10-3-5-11(16)6-4-10/h1,3-6,8-9H,7H2,(H,17,20) |
| InChIKey | RROPZLZBDSMDJQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|