C17H19N3O2S — CID 134797314
N-(3-methoxypropyl)-2-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 134797314) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-(3-methoxypropyl)-2-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 134797314 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(3-methoxypropyl)-2-(4-methylphenyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | COCCCNC(=O)c1cn2cc(-c3ccc(C)cc3)sc2n1 |
| InChI | InChI=1S/C17H19N3O2S/c1-12-4-6-13(7-5-12)15-11-20-10-14(19-17(20)23-15)16(21)18-8-3-9-22-2/h4-7,10-11H,3,8-9H2,1-2H3,(H,18,21) |
| InChIKey | VPCPHXJLCRLXCF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|