C18H18F3N5O2S — CID 134797144
CID 134797144 (PubChem CID 134797144) has the molecular formula C18H18F3N5O2S and a molecular weight of 425.44 g/mol.
| Compound Name | CID 134797144 |
|---|---|
| PubChem CID | 134797144 |
| Molecular Formula | C18H18F3N5O2S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | — |
| SMILES | O=[S+]([O-])(c1cccc(C(F)(F)F)c1)N1CCCN(c2ccnc3ccnn23)CC1 |
| InChI | InChI=1S/C18H18F3N5O2S/c19-18(20,21)14-3-1-4-15(13-14)29(27,28)25-10-2-9-24(11-12-25)17-6-7-22-16-5-8-23-26(16)17/h1,3-8,13H,2,9-12H2 |
| InChIKey | ODNCODSKOCMPPZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|