C10H15N3O2 — CID 134797788
N-(3-cyclopropyl-1-methylpyrazol-5-yl)-2-methoxyacetamide (PubChem CID 134797788) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-(3-cyclopropyl-1-methylpyrazol-5-yl)-2-methoxyacetamide.
| Compound Name | N-(3-cyclopropyl-1-methylpyrazol-5-yl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 134797788 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-(3-cyclopropyl-1-methylpyrazol-5-yl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(C2CC2)nn1C |
| InChI | InChI=1S/C10H15N3O2/c1-13-9(11-10(14)6-15-2)5-8(12-13)7-3-4-7/h5,7H,3-4,6H2,1-2H3,(H,11,14) |
| InChIKey | RXGJPQTYPWQYNG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |