C9H13N3O2 — CID 134798076
methyl N-(3-cyclopropyl-1-methylpyrazol-5-yl)carbamate (PubChem CID 134798076) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl N-(3-cyclopropyl-1-methylpyrazol-5-yl)carbamate.
| Compound Name | methyl N-(3-cyclopropyl-1-methylpyrazol-5-yl)carbamate |
|---|---|
| PubChem CID | 134798076 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | methyl N-(3-cyclopropyl-1-methylpyrazol-5-yl)carbamate |
| SMILES | COC(=O)Nc1cc(C2CC2)nn1C |
| InChI | InChI=1S/C9H13N3O2/c1-12-8(10-9(13)14-2)5-7(11-12)6-3-4-6/h5-6H,3-4H2,1-2H3,(H,10,13) |
| InChIKey | FOALNDJTGDKBJR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |