C23H25N3O3 — CID 134798872
N-[2-(3-ethoxypropylamino)-2-oxoethyl]-4-quinolin-3-ylbenzamide (PubChem CID 134798872) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[2-(3-ethoxypropylamino)-2-oxoethyl]-4-quinolin-3-ylbenzamide.
| Compound Name | N-[2-(3-ethoxypropylamino)-2-oxoethyl]-4-quinolin-3-ylbenzamide |
|---|---|
| PubChem CID | 134798872 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[2-(3-ethoxypropylamino)-2-oxoethyl]-4-quinolin-3-ylbenzamide |
| SMILES | CCOCCCNC(=O)CNC(=O)c1ccc(-c2cnc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-2-29-13-5-12-24-22(27)16-26-23(28)18-10-8-17(9-11-18)20-14-19-6-3-4-7-21(19)25-15-20/h3-4,6-11,14-15H,2,5,12-13,16H2,1H3,(H,24,27)(H,26,28) |
| InChIKey | IDOIEBHQPFYUME-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|