C22H27ClN2O — CID 134799026
1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 134799026) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is 1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | 1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134799026 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(-c2cccc(CN3CCCC3C(=O)NC(C)C)c2)cc1Cl |
| InChI | InChI=1S/C22H27ClN2O/c1-15(2)24-22(26)21-8-5-11-25(21)14-17-6-4-7-18(12-17)19-10-9-16(3)20(23)13-19/h4,6-7,9-10,12-13,15,21H,5,8,11,14H2,1-3H3,(H,24,26) |
| InChIKey | PTTLYWPTGOMINO-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |