C24H29ClN2O — CID 134799361
1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpyrrolidine-2-carboxamide (PubChem CID 134799361) has the molecular formula C24H29ClN2O and a molecular weight of 396.96 g/mol. Its IUPAC name is 1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpyrrolidine-2-carboxamide.
| Compound Name | 1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134799361 |
| Molecular Formula | C24H29ClN2O |
| Molecular Weight | 396.96 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 1-[[3-(3-chloro-4-methylphenyl)phenyl]methyl]-N-cyclopentylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(-c2cccc(CN3CCCC3C(=O)NC3CCCC3)c2)cc1Cl |
| InChI | InChI=1S/C24H29ClN2O/c1-17-11-12-20(15-22(17)25)19-7-4-6-18(14-19)16-27-13-5-10-23(27)24(28)26-21-8-2-3-9-21/h4,6-7,11-12,14-15,21,23H,2-3,5,8-10,13,16H2,1H3,(H,26,28) |
| InChIKey | UHASCARBFYLZQS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.96 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |