C26H26FN3O3 — CID 134799087
1-(2-fluorophenyl)-3-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]urea (PubChem CID 134799087) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]urea.
| Compound Name | 1-(2-fluorophenyl)-3-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 134799087 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[1-[4-(3-methoxyphenyl)benzoyl]piperidin-4-yl]urea |
| SMILES | COc1cccc(-c2ccc(C(=O)N3CCC(NC(=O)Nc4ccccc4F)CC3)cc2)c1 |
| InChI | InChI=1S/C26H26FN3O3/c1-33-22-6-4-5-20(17-22)18-9-11-19(12-10-18)25(31)30-15-13-21(14-16-30)28-26(32)29-24-8-3-2-7-23(24)27/h2-12,17,21H,13-16H2,1H3,(H2,28,29,32) |
| InChIKey | RLXFLDRXCNNPLE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |