C18H25FN4O3 — CID 74235645
N-cyclopropyl-2-[4-[(2-fluoro-4-methoxyphenyl)carbamoylamino]piperidin-1-yl]acetamide (PubChem CID 74235645) has the molecular formula C18H25FN4O3 and a molecular weight of 364.42 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[(2-fluoro-4-methoxyphenyl)carbamoylamino]piperidin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[(2-fluoro-4-methoxyphenyl)carbamoylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 74235645 |
| Molecular Formula | C18H25FN4O3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-cyclopropyl-2-[4-[(2-fluoro-4-methoxyphenyl)carbamoylamino]piperidin-1-yl]acetamide |
| SMILES | COc1ccc(NC(=O)NC2CCN(CC(=O)NC3CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H25FN4O3/c1-26-14-4-5-16(15(19)10-14)22-18(25)21-13-6-8-23(9-7-13)11-17(24)20-12-2-3-12/h4-5,10,12-13H,2-3,6-9,11H2,1H3,(H,20,24)(H2,21,22,25) |
| InChIKey | NWZONIKUVFCVDU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |