C21H29N5O3 — CID 134801337
3-methoxy-N-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]piperidin-3-yl]benzamide (PubChem CID 134801337) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 3-methoxy-N-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]piperidin-3-yl]benzamide.
| Compound Name | 3-methoxy-N-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 134801337 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 3-methoxy-N-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]piperidin-3-yl]benzamide |
| SMILES | COc1cccc(C(=O)NC2CCCN(CCn3nc4n(c3=O)CCCC4)C2)c1 |
| InChI | InChI=1S/C21H29N5O3/c1-29-18-8-4-6-16(14-18)20(27)22-17-7-5-10-24(15-17)12-13-26-21(28)25-11-3-2-9-19(25)23-26/h4,6,8,14,17H,2-3,5,7,9-13,15H2,1H3,(H,22,27) |
| InChIKey | MLFHQOBXAZURKE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |