C19H25ClN6O2 — CID 134801279
1-(4-chlorophenyl)-3-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]pyrrolidin-3-yl]urea (PubChem CID 134801279) has the molecular formula C19H25ClN6O2 and a molecular weight of 404.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]pyrrolidin-3-yl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 134801279 |
| Molecular Formula | C19H25ClN6O2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[1-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl]pyrrolidin-3-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCN(CCn2nc3n(c2=O)CCCC3)C1 |
| InChI | InChI=1S/C19H25ClN6O2/c20-14-4-6-15(7-5-14)21-18(27)22-16-8-10-24(13-16)11-12-26-19(28)25-9-2-1-3-17(25)23-26/h4-7,16H,1-3,8-13H2,(H2,21,22,27) |
| InChIKey | BBTJEUNYDPEPTK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |